C23H41N3 — CID 129089599
(1Z,3E,5Z)-1-N'-[1-(butylamino)but-3-enyl]-1-N,1-N'-dimethyl-3-prop-2-enyldeca-1,3,5-triene-1,1-diamine (PubChem CID 129089599) has the molecular formula C23H41N3 and a molecular weight of 359.60 g/mol. Its IUPAC name is (1Z,3E,5Z)-1-N'-[1-(butylamino)but-3-enyl]-1-N,1-N'-dimethyl-3-prop-2-enyldeca-1,3,5-triene-1,1-diamine.
| Compound Name | (1Z,3E,5Z)-1-N'-[1-(butylamino)but-3-enyl]-1-N,1-N'-dimethyl-3-prop-2-enyldeca-1,3,5-triene-1,1-diamine |
|---|---|
| PubChem CID | 129089599 |
| Molecular Formula | C23H41N3 |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.33 |
| IUPAC Name | (1Z,3E,5Z)-1-N'-[1-(butylamino)but-3-enyl]-1-N,1-N'-dimethyl-3-prop-2-enyldeca-1,3,5-triene-1,1-diamine |
| SMILES | C=CCC(/C=C(/NC)N(C)C(CC=C)NCCCC)=C\C=C/CCCC |
| InChI | InChI=1S/C23H41N3/c1-7-11-13-14-15-18-21(16-9-3)20-23(24-5)26(6)22(17-10-4)25-19-12-8-2/h9-10,14-15,18,20,22,24-25H,3-4,7-8,11-13,16-17,19H2,1-2,5-6H3/b15-14-,21-18+,23-20- |
| InChIKey | DATHNOWUPPUBQX-APXZSWKOSA-N |
| XLogP | 5.52 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|