C18H20S — CID 129089719
6,6,12,12-tetramethyl-9-thiatricyclo[8.5.0.02,8]pentadeca-1(15),2,4,7,10,13-hexaene (PubChem CID 129089719) has the molecular formula C18H20S and a molecular weight of 268.43 g/mol. Its IUPAC name is 6,6,12,12-tetramethyl-9-thiatricyclo[8.5.0.02,8]pentadeca-1(15),2,4,7,10,13-hexaene.
| Compound Name | 6,6,12,12-tetramethyl-9-thiatricyclo[8.5.0.02,8]pentadeca-1(15),2,4,7,10,13-hexaene |
|---|---|
| PubChem CID | 129089719 |
| Molecular Formula | C18H20S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 6,6,12,12-tetramethyl-9-thiatricyclo[8.5.0.02,8]pentadeca-1(15),2,4,7,10,13-hexaene |
| SMILES | CC1(C)C=CC=c2c(sc3c2=CC=CC(C)(C)C=3)=C1 |
| InChI | InChI=1S/C18H20S/c1-17(2)9-5-7-13-14-8-6-10-18(3,4)12-16(14)19-15(13)11-17/h5-12H,1-4H3 |
| InChIKey | PRJMAJXYEDSQFR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |