C41H30N4 — CID 129089763
3'-[(1Z)-buta-1,3-dienyl]-2'-methyl-1',2-diphenyl-4-pyridin-3-ylspiro[indeno[1,2-d]pyrimidine-5,4'-quinoline] (PubChem CID 129089763) has the molecular formula C41H30N4 and a molecular weight of 578.72 g/mol. Its IUPAC name is 3'-[(1Z)-buta-1,3-dienyl]-2'-methyl-1',2-diphenyl-4-pyridin-3-ylspiro[indeno[1,2-d]pyrimidine-5,4'-quinoline].
| Compound Name | 3'-[(1Z)-buta-1,3-dienyl]-2'-methyl-1',2-diphenyl-4-pyridin-3-ylspiro[indeno[1,2-d]pyrimidine-5,4'-quinoline] |
|---|---|
| PubChem CID | 129089763 |
| Molecular Formula | C41H30N4 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.25 |
| IUPAC Name | 3'-[(1Z)-buta-1,3-dienyl]-2'-methyl-1',2-diphenyl-4-pyridin-3-ylspiro[indeno[1,2-d]pyrimidine-5,4'-quinoline] |
| SMILES | C=C/C=C\C1=C(C)N(c2ccccc2)c2ccccc2C12c1ccccc1-c1nc(-c3ccccc3)nc(-c3cccnc3)c12 |
| InChI | InChI=1S/C41H30N4/c1-3-4-22-33-28(2)45(31-19-9-6-10-20-31)36-25-14-13-24-35(36)41(33)34-23-12-11-21-32(34)39-37(41)38(30-18-15-26-42-27-30)43-40(44-39)29-16-7-5-8-17-29/h3-27H,1H2,2H3/b22-4- |
| InChIKey | MFQZPUZXFQQCCY-OZDWGKQUSA-N |
| XLogP | 9.69 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|