C16H24N2 — CID 129090141
N-[(Z)-ethylideneamino]-N-[1-(2,3,4,5-tetramethylcyclopenta-1,4-dien-1-yl)ethenyl]prop-1-en-2-amine (PubChem CID 129090141) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-[(Z)-ethylideneamino]-N-[1-(2,3,4,5-tetramethylcyclopenta-1,4-dien-1-yl)ethenyl]prop-1-en-2-amine.
| Compound Name | N-[(Z)-ethylideneamino]-N-[1-(2,3,4,5-tetramethylcyclopenta-1,4-dien-1-yl)ethenyl]prop-1-en-2-amine |
|---|---|
| PubChem CID | 129090141 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-[(Z)-ethylideneamino]-N-[1-(2,3,4,5-tetramethylcyclopenta-1,4-dien-1-yl)ethenyl]prop-1-en-2-amine |
| SMILES | C=C(C)N(/N=C\C)C(=C)C1=C(C)C(C)C(C)=C1C |
| InChI | InChI=1S/C16H24N2/c1-9-17-18(10(2)3)15(8)16-13(6)11(4)12(5)14(16)7/h9,11H,2,8H2,1,3-7H3/b17-9- |
| InChIKey | OZNUMCKKTHPJBL-MFOYZWKCSA-N |
| XLogP | 4.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|