C17H24N2 — CID 129090482
(1Z,3Z)-N,2,3-trimethyl-5-(2,4,6-trimethyl-3-pyridinyl)hexa-1,3,5-trien-1-amine (PubChem CID 129090482) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is (1Z,3Z)-N,2,3-trimethyl-5-(2,4,6-trimethyl-3-pyridinyl)hexa-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z)-N,2,3-trimethyl-5-(2,4,6-trimethyl-3-pyridinyl)hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 129090482 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | (1Z,3Z)-N,2,3-trimethyl-5-(2,4,6-trimethyl-3-pyridinyl)hexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C(C)\C(C)=C/NC)c1c(C)cc(C)nc1C |
| InChI | InChI=1S/C17H24N2/c1-11(14(4)10-18-7)8-12(2)17-13(3)9-15(5)19-16(17)6/h8-10,18H,2H2,1,3-7H3/b11-8-,14-10- |
| InChIKey | OHLASUDZSNYLEI-JLKXBCQYSA-N |
| XLogP | 4.09 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|