About (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine
(3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine (PubChem CID 129090549) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine.
Molecular Properties
| Compound Name | (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine |
| PubChem CID | 129090549 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine |
| SMILES | C/C=C\C=C/C(N)COC |
| InChI | InChI=1S/C8H15NO/c1-3-4-5-6-8(9)7-10-2/h3-6,8H,7,9H2,1-2H3/b4-3-,6-5- |
| InChIKey | DOIICKHNUOTUPX-OUPQRBNQSA-N |
| XLogP | 1.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine?
The IUPAC name of (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine (CID 129090549) is (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine.
What is the SMILES notation for (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine?
The canonical SMILES for (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine is C/C=C\C=C/C(N)COC.
What is the InChIKey of (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine?
The InChIKey is DOIICKHNUOTUPX-OUPQRBNQSA-N. The full InChI is InChI=1S/C8H15NO/c1-3-4-5-6-8(9)7-10-2/h3-6,8H,7,9H2,1-2H3/b4-3-,6-5-.
What are the key properties of (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine?
(3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine has a molecular weight of 141.21 g/mol, XLogP of 1.09, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,5Z)-1-methoxyhepta-3,5-dien-2-amine is sourced from PubChem (CID 129090549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).