C22H18ClF3N6O2S — CID 129090603
N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[(1R)-1-[[(E)-4-methylimino-4-pyridin-3-ylbut-2-enoyl]amino]ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 129090603) has the molecular formula C22H18ClF3N6O2S and a molecular weight of 522.94 g/mol. Its IUPAC name is N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[(1R)-1-[[(E)-4-methylimino-4-pyridin-3-ylbut-2-enoyl]amino]ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[(1R)-1-[[(E)-4-methylimino-4-pyridin-3-ylbut-2-enoyl]amino]ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 129090603 |
| Molecular Formula | C22H18ClF3N6O2S |
| Molecular Weight | 522.94 g/mol |
| Exact Mass | 522.09 |
| IUPAC Name | N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[(1R)-1-[[(E)-4-methylimino-4-pyridin-3-ylbut-2-enoyl]amino]ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | C/N=C(/C=C/C(=O)N[C@H](C)c1ncc(C(=O)Nc2cc(C(F)(F)F)c(Cl)cn2)s1)c1cccnc1 |
| InChI | InChI=1S/C22H18ClF3N6O2S/c1-12(31-19(33)6-5-16(27-2)13-4-3-7-28-9-13)21-30-11-17(35-21)20(34)32-18-8-14(22(24,25)26)15(23)10-29-18/h3-12H,1-2H3,(H,31,33)(H,29,32,34)/b6-5+,27-16-/t12-/m1/s1 |
| InChIKey | OEDDTMANXDEVCV-WYVPPFHUSA-N |
| XLogP | 4.71 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|