C24H19ClF4N6O2S — CID 129090903
N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[1-[[(E)-4-ethenylimino-4-(2-fluoro-4-pyridinyl)-2-methylbut-2-enoyl]amino]ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 129090903) has the molecular formula C24H19ClF4N6O2S and a molecular weight of 566.97 g/mol. Its IUPAC name is N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[1-[[(E)-4-ethenylimino-4-(2-fluoro-4-pyridinyl)-2-methylbut-2-enoyl]amino]ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[1-[[(E)-4-ethenylimino-4-(2-fluoro-4-pyridinyl)-2-methylbut-2-enoyl]amino]ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 129090903 |
| Molecular Formula | C24H19ClF4N6O2S |
| Molecular Weight | 566.97 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | N-[5-chloro-4-(trifluoromethyl)-2-pyridinyl]-2-[1-[[(E)-4-ethenylimino-4-(2-fluoro-4-pyridinyl)-2-methylbut-2-enoyl]amino]ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | C=C/N=C(/C=C(\C)C(=O)NC(C)c1ncc(C(=O)Nc2cc(C(F)(F)F)c(Cl)cn2)s1)c1ccnc(F)c1 |
| InChI | InChI=1S/C24H19ClF4N6O2S/c1-4-30-17(14-5-6-31-19(26)8-14)7-12(2)21(36)34-13(3)23-33-11-18(38-23)22(37)35-20-9-15(24(27,28)29)16(25)10-32-20/h4-11,13H,1H2,2-3H3,(H,34,36)(H,32,35,37)/b12-7+,30-17- |
| InChIKey | BQDOFTIIYARRJR-LRFWIZGTSA-N |
| XLogP | 5.75 |
| TPSA | 109.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.97 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|