About 7-nitroso-3,4-dihydro-2H-chromen-5-ol
7-nitroso-3,4-dihydro-2H-chromen-5-ol (PubChem CID 129090968) has the molecular formula C9H9NO3
and a molecular weight of 179.18 g/mol. Its IUPAC name is 7-nitroso-3,4-dihydro-2H-chromen-5-ol.
Molecular Properties
| Compound Name | 7-nitroso-3,4-dihydro-2H-chromen-5-ol |
| PubChem CID | 129090968 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 7-nitroso-3,4-dihydro-2H-chromen-5-ol |
| SMILES | O=Nc1cc(O)c2c(c1)OCCC2 |
| InChI | InChI=1S/C9H9NO3/c11-8-4-6(10-12)5-9-7(8)2-1-3-13-9/h4-5,11H,1-3H2 |
| InChIKey | KYRBVXHRHXFBQE-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-nitroso-3,4-dihydro-2H-chromen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-nitroso-3,4-dihydro-2H-chromen-5-ol?
The IUPAC name of 7-nitroso-3,4-dihydro-2H-chromen-5-ol (CID 129090968) is 7-nitroso-3,4-dihydro-2H-chromen-5-ol.
What is the SMILES notation for 7-nitroso-3,4-dihydro-2H-chromen-5-ol?
The canonical SMILES for 7-nitroso-3,4-dihydro-2H-chromen-5-ol is O=Nc1cc(O)c2c(c1)OCCC2.
What is the InChIKey of 7-nitroso-3,4-dihydro-2H-chromen-5-ol?
The InChIKey is KYRBVXHRHXFBQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c11-8-4-6(10-12)5-9-7(8)2-1-3-13-9/h4-5,11H,1-3H2.
What are the key properties of 7-nitroso-3,4-dihydro-2H-chromen-5-ol?
7-nitroso-3,4-dihydro-2H-chromen-5-ol has a molecular weight of 179.18 g/mol, XLogP of 2.12, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-nitroso-3,4-dihydro-2H-chromen-5-ol is sourced from PubChem (CID 129090968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).