C19H18F3N5O3S — CID 129091009
2-[(1R)-1-[[(2Z)-2-(ethylideneamino)penta-2,4-dienoyl]amino]ethyl]-N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide (PubChem CID 129091009) has the molecular formula C19H18F3N5O3S and a molecular weight of 453.45 g/mol. Its IUPAC name is 2-[(1R)-1-[[(2Z)-2-(ethylideneamino)penta-2,4-dienoyl]amino]ethyl]-N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 2-[(1R)-1-[[(2Z)-2-(ethylideneamino)penta-2,4-dienoyl]amino]ethyl]-N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 129091009 |
| Molecular Formula | C19H18F3N5O3S |
| Molecular Weight | 453.45 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 2-[(1R)-1-[[(2Z)-2-(ethylideneamino)penta-2,4-dienoyl]amino]ethyl]-N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-1,3-thiazole-5-carboxamide |
| SMILES | C=C/C=C(\N=C\C)C(=O)N[C@H](C)c1ncc(C(=O)Nc2cc(C(F)(F)F)c(O)cn2)s1 |
| InChI | InChI=1S/C19H18F3N5O3S/c1-4-6-12(23-5-2)16(29)26-10(3)18-25-9-14(31-18)17(30)27-15-7-11(19(20,21)22)13(28)8-24-15/h4-10,28H,1H2,2-3H3,(H,26,29)(H,24,27,30)/b12-6-,23-5+/t10-/m1/s1 |
| InChIKey | SHFKHONWZJPIMS-DAKKHBLQSA-N |
| XLogP | 3.85 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|