C17H23NO — CID 129091110
1-[(3E)-4-[(E)-oct-1-enyl]-1-azacycloocta-1,3,6,7-tetraen-2-yl]ethanone (PubChem CID 129091110) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 1-[(3E)-4-[(E)-oct-1-enyl]-1-azacycloocta-1,3,6,7-tetraen-2-yl]ethanone.
| Compound Name | 1-[(3E)-4-[(E)-oct-1-enyl]-1-azacycloocta-1,3,6,7-tetraen-2-yl]ethanone |
|---|---|
| PubChem CID | 129091110 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 1-[(3E)-4-[(E)-oct-1-enyl]-1-azacycloocta-1,3,6,7-tetraen-2-yl]ethanone |
| SMILES | CCCCCC/C=C/C1=C/C(C(C)=O)=N\C=C=CC1 |
| InChI | InChI=1S/C17H23NO/c1-3-4-5-6-7-8-11-16-12-9-10-13-18-17(14-16)15(2)19/h8-9,11,13-14H,3-7,12H2,1-2H3/b11-8+,16-14-,18-17+ |
| InChIKey | QZPVTRCJBOACAO-RAGDMEAVSA-N |
| XLogP | 4.54 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|