C23H23F3N8O3S — CID 129091154
N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-2-[1-[[(2E)-4-[2-(pyrimidin-4-ylamino)ethylamino]penta-2,4-dienoyl]amino]ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 129091154) has the molecular formula C23H23F3N8O3S and a molecular weight of 548.55 g/mol. Its IUPAC name is N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-2-[1-[[(2E)-4-[2-(pyrimidin-4-ylamino)ethylamino]penta-2,4-dienoyl]amino]ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-2-[1-[[(2E)-4-[2-(pyrimidin-4-ylamino)ethylamino]penta-2,4-dienoyl]amino]ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 129091154 |
| Molecular Formula | C23H23F3N8O3S |
| Molecular Weight | 548.55 g/mol |
| Exact Mass | 548.16 |
| IUPAC Name | N-[5-hydroxy-4-(trifluoromethyl)-2-pyridinyl]-2-[1-[[(2E)-4-[2-(pyrimidin-4-ylamino)ethylamino]penta-2,4-dienoyl]amino]ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | C=C(/C=C/C(=O)NC(C)c1ncc(C(=O)Nc2cc(C(F)(F)F)c(O)cn2)s1)NCCNc1ccncn1 |
| InChI | InChI=1S/C23H23F3N8O3S/c1-13(28-7-8-29-18-5-6-27-12-32-18)3-4-20(36)33-14(2)22-31-11-17(38-22)21(37)34-19-9-15(23(24,25)26)16(35)10-30-19/h3-6,9-12,14,28,35H,1,7-8H2,2H3,(H,33,36)(H,27,29,32)(H,30,34,37)/b4-3+ |
| InChIKey | FFSLWVMMNZAIAH-ONEGZZNKSA-N |
| XLogP | 3.25 |
| TPSA | 154.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.55 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|