C18H27NO — CID 129091506
(3Z,6E)-4-ethyl-3-(ethylideneamino)-5-methylidenetrideca-3,6,12-trien-2-one (PubChem CID 129091506) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is (3Z,6E)-4-ethyl-3-(ethylideneamino)-5-methylidenetrideca-3,6,12-trien-2-one.
| Compound Name | (3Z,6E)-4-ethyl-3-(ethylideneamino)-5-methylidenetrideca-3,6,12-trien-2-one |
|---|---|
| PubChem CID | 129091506 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (3Z,6E)-4-ethyl-3-(ethylideneamino)-5-methylidenetrideca-3,6,12-trien-2-one |
| SMILES | C=CCCCC/C=C/C(=C)/C(CC)=C(\N=C\C)C(C)=O |
| InChI | InChI=1S/C18H27NO/c1-6-9-10-11-12-13-14-15(4)17(7-2)18(16(5)20)19-8-3/h6,8,13-14H,1,4,7,9-12H2,2-3,5H3/b14-13+,18-17-,19-8+ |
| InChIKey | SGVXDLGUSSNUHL-MQQHQWIESA-N |
| XLogP | 5.19 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|