About 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde
6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde (PubChem CID 129091559) has the molecular formula C10H10F3NO3
and a molecular weight of 249.19 g/mol. Its IUPAC name is 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde.
Molecular Properties
| Compound Name | 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde |
| PubChem CID | 129091559 |
| Molecular Formula | C10H10F3NO3 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde |
| SMILES | O=Cc1ccc(OCCOCC(F)(F)F)nc1 |
| InChI | InChI=1S/C10H10F3NO3/c11-10(12,13)7-16-3-4-17-9-2-1-8(6-15)5-14-9/h1-2,5-6H,3-4,7H2 |
| InChIKey | WTUULYKWJAFCTQ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde?
The IUPAC name of 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde (CID 129091559) is 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde.
What is the SMILES notation for 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde?
The canonical SMILES for 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde is O=Cc1ccc(OCCOCC(F)(F)F)nc1.
What is the InChIKey of 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde?
The InChIKey is WTUULYKWJAFCTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10F3NO3/c11-10(12,13)7-16-3-4-17-9-2-1-8(6-15)5-14-9/h1-2,5-6H,3-4,7H2.
What are the key properties of 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde?
6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde has a molecular weight of 249.19 g/mol, XLogP of 1.85, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(2,2,2-trifluoroethoxy)ethoxy]pyridine-3-carbaldehyde is sourced from PubChem (CID 129091559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).