C7H9IN2O — CID 129091604
3-iodo-4,5,6,7-tetrahydro-1H-indazol-6-ol (PubChem CID 129091604) has the molecular formula C7H9IN2O and a molecular weight of 264.07 g/mol. Its IUPAC name is 3-iodo-4,5,6,7-tetrahydro-1H-indazol-6-ol.
| Compound Name | 3-iodo-4,5,6,7-tetrahydro-1H-indazol-6-ol |
|---|---|
| PubChem CID | 129091604 |
| Molecular Formula | C7H9IN2O |
| Molecular Weight | 264.07 g/mol |
| Exact Mass | 263.98 |
| IUPAC Name | 3-iodo-4,5,6,7-tetrahydro-1H-indazol-6-ol |
| SMILES | OC1CCc2c(I)n[nH]c2C1 |
| InChI | InChI=1S/C7H9IN2O/c8-7-5-2-1-4(11)3-6(5)9-10-7/h4,11H,1-3H2,(H,9,10) |
| InChIKey | IUBYBGQOXRLEKK-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.07 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|