C7H16N2O2S2 — CID 129091804
N,N-dimethyl-1-sulfanylpiperidine-4-sulfonamide (PubChem CID 129091804) has the molecular formula C7H16N2O2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is N,N-dimethyl-1-sulfanylpiperidine-4-sulfonamide.
| Compound Name | N,N-dimethyl-1-sulfanylpiperidine-4-sulfonamide |
|---|---|
| PubChem CID | 129091804 |
| Molecular Formula | C7H16N2O2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N,N-dimethyl-1-sulfanylpiperidine-4-sulfonamide |
| SMILES | CN(C)S(=O)(=O)C1CCN(S)CC1 |
| InChI | InChI=1S/C7H16N2O2S2/c1-8(2)13(10,11)7-3-5-9(12)6-4-7/h7,12H,3-6H2,1-2H3 |
| InChIKey | ZIZITLLFCUZCMH-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|