C32H47N9O4 — CID 129092758
N-[2-[3-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methylphenyl]methyl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2-(methylideneamino)oxyacetamide (PubChem CID 129092758) has the molecular formula C32H47N9O4 and a molecular weight of 621.79 g/mol. Its IUPAC name is N-[2-[3-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methylphenyl]methyl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2-(methylideneamino)oxyacetamide.
| Compound Name | N-[2-[3-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methylphenyl]methyl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2-(methylideneamino)oxyacetamide |
|---|---|
| PubChem CID | 129092758 |
| Molecular Formula | C32H47N9O4 |
| Molecular Weight | 621.79 g/mol |
| Exact Mass | 621.38 |
| IUPAC Name | N-[2-[3-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methylphenyl]methyl]piperazin-1-yl]-3-oxopropoxy]ethyl]-2-(methylideneamino)oxyacetamide |
| SMILES | C=NOCC(=O)NCCOCCC(=O)N1CCN(Cc2ccc(Cn3ccc4nc(N)nc(NCCCCC)c43)c(C)c2)CC1 |
| InChI | InChI=1S/C32H47N9O4/c1-4-5-6-11-36-31-30-27(37-32(33)38-31)9-13-41(30)22-26-8-7-25(20-24(26)2)21-39-14-16-40(17-15-39)29(43)10-18-44-19-12-35-28(42)23-45-34-3/h7-9,13,20H,3-6,10-12,14-19,21-23H2,1-2H3,(H,35,42)(H3,33,36,37,38) |
| InChIKey | VXJGXAHRCHWBRC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 152.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.79 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|