C33H51N9O4 — CID 129092766
N-[2-[2-[2-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methylphenyl]methyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]-2-(methylideneamino)oxyacetamide (PubChem CID 129092766) has the molecular formula C33H51N9O4 and a molecular weight of 637.83 g/mol. Its IUPAC name is N-[2-[2-[2-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methylphenyl]methyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]-2-(methylideneamino)oxyacetamide.
| Compound Name | N-[2-[2-[2-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methylphenyl]methyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]-2-(methylideneamino)oxyacetamide |
|---|---|
| PubChem CID | 129092766 |
| Molecular Formula | C33H51N9O4 |
| Molecular Weight | 637.83 g/mol |
| Exact Mass | 637.41 |
| IUPAC Name | N-[2-[2-[2-[4-[[4-[[2-amino-4-(pentylamino)pyrrolo[3,2-d]pyrimidin-5-yl]methyl]-3-methylphenyl]methyl]piperazin-1-yl]ethoxy]ethoxy]ethyl]-2-(methylideneamino)oxyacetamide |
| SMILES | C=NOCC(=O)NCCOCCOCCN1CCN(Cc2ccc(Cn3ccc4nc(N)nc(NCCCCC)c43)c(C)c2)CC1 |
| InChI | InChI=1S/C33H51N9O4/c1-4-5-6-10-37-32-31-29(38-33(34)39-32)9-12-42(31)24-28-8-7-27(22-26(28)2)23-41-15-13-40(14-16-41)17-19-45-21-20-44-18-11-36-30(43)25-46-35-3/h7-9,12,22H,3-6,10-11,13-21,23-25H2,1-2H3,(H,36,43)(H3,34,37,38,39) |
| InChIKey | ULWALLICYSEZGF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 144.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.83 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|