C12H8N2O5 — CID 12909282
4H-imidazo[2,1-c][1,4]benzoxazine-1,2-dicarboxylic acid (PubChem CID 12909282) has the molecular formula C12H8N2O5 and a molecular weight of 260.20 g/mol. Its IUPAC name is 4H-imidazo[2,1-c][1,4]benzoxazine-1,2-dicarboxylic acid.
| Compound Name | 4H-imidazo[2,1-c][1,4]benzoxazine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 12909282 |
| Molecular Formula | C12H8N2O5 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 4H-imidazo[2,1-c][1,4]benzoxazine-1,2-dicarboxylic acid |
| SMILES | O=C(O)c1nc2n(c1C(=O)O)-c1ccccc1OC2 |
| InChI | InChI=1S/C12H8N2O5/c15-11(16)9-10(12(17)18)14-6-3-1-2-4-7(6)19-5-8(14)13-9/h1-4H,5H2,(H,15,16)(H,17,18) |
| InChIKey | WJFJLYKLNDXITO-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |