C11H10N2O2 — CID 12909288
4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol (PubChem CID 12909288) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol.
| Compound Name | 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol |
|---|---|
| PubChem CID | 12909288 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol |
| SMILES | OCc1cn2c(n1)COc1ccccc1-2 |
| InChI | InChI=1S/C11H10N2O2/c14-6-8-5-13-9-3-1-2-4-10(9)15-7-11(13)12-8/h1-5,14H,6-7H2 |
| InChIKey | OWSHQQWLKVGRIW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |