About 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol
4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol (PubChem CID 12909288) has the molecular formula C11H10N2O2
and a molecular weight of 202.21 g/mol. Its IUPAC name is 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol.
Molecular Properties
| Compound Name | 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol |
| PubChem CID | 12909288 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol |
| SMILES | OCc1cn2c(n1)COc1ccccc1-2 |
| InChI | InChI=1S/C11H10N2O2/c14-6-8-5-13-9-3-1-2-4-10(9)15-7-11(13)12-8/h1-5,14H,6-7H2 |
| InChIKey | OWSHQQWLKVGRIW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol?
The IUPAC name of 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol (CID 12909288) is 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol.
What is the SMILES notation for 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol?
The canonical SMILES for 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol is OCc1cn2c(n1)COc1ccccc1-2.
What is the InChIKey of 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol?
The InChIKey is OWSHQQWLKVGRIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2/c14-6-8-5-13-9-3-1-2-4-10(9)15-7-11(13)12-8/h1-5,14H,6-7H2.
What are the key properties of 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol?
4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol has a molecular weight of 202.21 g/mol, XLogP of 1.26, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-imidazo[2,1-c][1,4]benzoxazin-2-ylmethanol is sourced from PubChem (CID 12909288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).