C11H7N3O — CID 12909291
4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile (PubChem CID 12909291) has the molecular formula C11H7N3O and a molecular weight of 197.20 g/mol. Its IUPAC name is 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile.
| Compound Name | 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile |
|---|---|
| PubChem CID | 12909291 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile |
| SMILES | N#Cc1cn2c(n1)COc1ccccc1-2 |
| InChI | InChI=1S/C11H7N3O/c12-5-8-6-14-9-3-1-2-4-10(9)15-7-11(14)13-8/h1-4,6H,7H2 |
| InChIKey | OPDPWJMNJNISNU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |