About 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile
4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile (PubChem CID 12909291) has the molecular formula C11H7N3O
and a molecular weight of 197.20 g/mol. Its IUPAC name is 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile.
Molecular Properties
| Compound Name | 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile |
| PubChem CID | 12909291 |
| Molecular Formula | C11H7N3O |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile |
| SMILES | N#Cc1cn2c(n1)COc1ccccc1-2 |
| InChI | InChI=1S/C11H7N3O/c12-5-8-6-14-9-3-1-2-4-10(9)15-7-11(14)13-8/h1-4,6H,7H2 |
| InChIKey | OPDPWJMNJNISNU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 50.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile?
The IUPAC name of 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile (CID 12909291) is 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile.
What is the SMILES notation for 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile?
The canonical SMILES for 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile is N#Cc1cn2c(n1)COc1ccccc1-2.
What is the InChIKey of 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile?
The InChIKey is OPDPWJMNJNISNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3O/c12-5-8-6-14-9-3-1-2-4-10(9)15-7-11(14)13-8/h1-4,6H,7H2.
What are the key properties of 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile?
4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile has a molecular weight of 197.20 g/mol, XLogP of 1.64, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-imidazo[2,1-c][1,4]benzoxazine-2-carbonitrile is sourced from PubChem (CID 12909291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).