About 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride
2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride (PubChem CID 12909295) has the molecular formula C16H20ClN3O
and a molecular weight of 305.81 g/mol. Its IUPAC name is 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride.
Molecular Properties
| Compound Name | 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride |
| PubChem CID | 12909295 |
| Molecular Formula | C16H20ClN3O |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)OCc1nc(CN3CCCCC3)cn1-2 |
| InChI | InChI=1S/C16H19N3O.ClH/c1-4-8-18(9-5-1)10-13-11-19-14-6-2-3-7-15(14)20-12-16(19)17-13;/h2-3,6-7,11H,1,4-5,8-10,12H2;1H |
| InChIKey | RPPNCZXQUIBRIS-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride?
The IUPAC name of 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride (CID 12909295) is 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride.
What is the SMILES notation for 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride?
The canonical SMILES for 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride is Cl.c1ccc2c(c1)OCc1nc(CN3CCCCC3)cn1-2.
What is the InChIKey of 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride?
The InChIKey is RPPNCZXQUIBRIS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O.ClH/c1-4-8-18(9-5-1)10-13-11-19-14-6-2-3-7-15(14)20-12-16(19)17-13;/h2-3,6-7,11H,1,4-5,8-10,12H2;1H.
What are the key properties of 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride?
2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride has a molecular weight of 305.81 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(piperidin-1-ylmethyl)-4H-imidazo[2,1-c][1,4]benzoxazine;hydrochloride is sourced from PubChem (CID 12909295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).