About methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate
methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate (PubChem CID 12909301) has the molecular formula C16H15N3O6
and a molecular weight of 345.31 g/mol. Its IUPAC name is methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate |
| PubChem CID | 12909301 |
| Molecular Formula | C16H15N3O6 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate |
| SMILES | CCOC(=O)C(=O)Nc1ccc2c(c1)-n1cc(C(=O)OC)nc1CO2 |
| InChI | InChI=1S/C16H15N3O6/c1-3-24-16(22)14(20)17-9-4-5-12-11(6-9)19-7-10(15(21)23-2)18-13(19)8-25-12/h4-7H,3,8H2,1-2H3,(H,17,20) |
| InChIKey | SBRYVQWCVCCBNY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 108.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate?
The IUPAC name of methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate (CID 12909301) is methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate.
What is the SMILES notation for methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate?
The canonical SMILES for methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate is CCOC(=O)C(=O)Nc1ccc2c(c1)-n1cc(C(=O)OC)nc1CO2.
What is the InChIKey of methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate?
The InChIKey is SBRYVQWCVCCBNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O6/c1-3-24-16(22)14(20)17-9-4-5-12-11(6-9)19-7-10(15(21)23-2)18-13(19)8-25-12/h4-7H,3,8H2,1-2H3,(H,17,20).
What are the key properties of methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate?
methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate has a molecular weight of 345.31 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[(2-ethoxy-2-oxoacetyl)amino]-4H-imidazo[2,1-c][1,4]benzoxazine-2-carboxylate is sourced from PubChem (CID 12909301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).