About 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine
1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine (PubChem CID 129093171) has the molecular formula C8H16N2
and a molecular weight of 140.23 g/mol. Its IUPAC name is 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine.
Molecular Properties
| Compound Name | 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine |
| PubChem CID | 129093171 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine |
| SMILES | CNN/C=C\C=C\C(C)C |
| InChI | InChI=1S/C8H16N2/c1-8(2)6-4-5-7-10-9-3/h4-10H,1-3H3/b6-4+,7-5- |
| InChIKey | AGARWDWCJHZNMB-GUBXDBFYSA-N |
| XLogP | 1.44 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine?
The IUPAC name of 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine (CID 129093171) is 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine.
What is the SMILES notation for 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine?
The canonical SMILES for 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine is CNN/C=C\C=C\C(C)C.
What is the InChIKey of 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine?
The InChIKey is AGARWDWCJHZNMB-GUBXDBFYSA-N. The full InChI is InChI=1S/C8H16N2/c1-8(2)6-4-5-7-10-9-3/h4-10H,1-3H3/b6-4+,7-5-.
What are the key properties of 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine?
1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine has a molecular weight of 140.23 g/mol, XLogP of 1.44, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-[(1Z,3E)-5-methylhexa-1,3-dienyl]hydrazine is sourced from PubChem (CID 129093171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).