C13H27N — CID 129093254
N-tert-butyl-N,3,4,4-tetramethylpent-1-en-2-amine (PubChem CID 129093254) has the molecular formula C13H27N and a molecular weight of 197.37 g/mol. Its IUPAC name is N-tert-butyl-N,3,4,4-tetramethylpent-1-en-2-amine.
| Compound Name | N-tert-butyl-N,3,4,4-tetramethylpent-1-en-2-amine |
|---|---|
| PubChem CID | 129093254 |
| Molecular Formula | C13H27N |
| Molecular Weight | 197.37 g/mol |
| Exact Mass | 197.21 |
| IUPAC Name | N-tert-butyl-N,3,4,4-tetramethylpent-1-en-2-amine |
| SMILES | C=C(C(C)C(C)(C)C)N(C)C(C)(C)C |
| InChI | InChI=1S/C13H27N/c1-10(12(3,4)5)11(2)14(9)13(6,7)8/h10H,2H2,1,3-9H3 |
| InChIKey | FDAGZYVRUBBYIE-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |