About 2-ethyl-3-propan-2-yl-2,3-dihydropyridine
2-ethyl-3-propan-2-yl-2,3-dihydropyridine (PubChem CID 129093497) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 2-ethyl-3-propan-2-yl-2,3-dihydropyridine.
Molecular Properties
| Compound Name | 2-ethyl-3-propan-2-yl-2,3-dihydropyridine |
| PubChem CID | 129093497 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 2-ethyl-3-propan-2-yl-2,3-dihydropyridine |
| SMILES | CCC1N=CC=CC1C(C)C |
| InChI | InChI=1S/C10H17N/c1-4-10-9(8(2)3)6-5-7-11-10/h5-10H,4H2,1-3H3 |
| InChIKey | GROYZHVOEGYMKC-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethyl-3-propan-2-yl-2,3-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-propan-2-yl-2,3-dihydropyridine?
The IUPAC name of 2-ethyl-3-propan-2-yl-2,3-dihydropyridine (CID 129093497) is 2-ethyl-3-propan-2-yl-2,3-dihydropyridine.
What is the SMILES notation for 2-ethyl-3-propan-2-yl-2,3-dihydropyridine?
The canonical SMILES for 2-ethyl-3-propan-2-yl-2,3-dihydropyridine is CCC1N=CC=CC1C(C)C.
What is the InChIKey of 2-ethyl-3-propan-2-yl-2,3-dihydropyridine?
The InChIKey is GROYZHVOEGYMKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-4-10-9(8(2)3)6-5-7-11-10/h5-10H,4H2,1-3H3.
What are the key properties of 2-ethyl-3-propan-2-yl-2,3-dihydropyridine?
2-ethyl-3-propan-2-yl-2,3-dihydropyridine has a molecular weight of 151.25 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-propan-2-yl-2,3-dihydropyridine is sourced from PubChem (CID 129093497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).