C21H22N4O2 — CID 129093812
3-[[[3-[3-(1,3-oxazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]amino]methyl]but-3-en-2-one (PubChem CID 129093812) has the molecular formula C21H22N4O2 and a molecular weight of 362.43 g/mol. Its IUPAC name is 3-[[[3-[3-(1,3-oxazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]amino]methyl]but-3-en-2-one.
| Compound Name | 3-[[[3-[3-(1,3-oxazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]amino]methyl]but-3-en-2-one |
|---|---|
| PubChem CID | 129093812 |
| Molecular Formula | C21H22N4O2 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | 3-[[[3-[3-(1,3-oxazol-5-yl)-1H-pyrrolo[2,3-b]pyridin-4-yl]cyclohex-3-en-1-yl]amino]methyl]but-3-en-2-one |
| SMILES | C=C(CNC1CCC=C(c2ccnc3[nH]cc(-c4cnco4)c23)C1)C(C)=O |
| InChI | InChI=1S/C21H22N4O2/c1-13(14(2)26)9-24-16-5-3-4-15(8-16)17-6-7-23-21-20(17)18(10-25-21)19-11-22-12-27-19/h4,6-7,10-12,16,24H,1,3,5,8-9H2,2H3,(H,23,25) |
| InChIKey | KPSBOCGZCIBEBH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|