C30H37N5O5 — CID 129093859
(2S)-N'-[(2-methylpropan-2-yl)oxy]-N-[(2S)-1-oxo-1-(quinolin-4-ylmethylamino)propan-2-yl]-2-(3-phenylpropanoylamino)butanediamide (PubChem CID 129093859) has the molecular formula C30H37N5O5 and a molecular weight of 547.66 g/mol. Its IUPAC name is (2S)-N'-[(2-methylpropan-2-yl)oxy]-N-[(2S)-1-oxo-1-(quinolin-4-ylmethylamino)propan-2-yl]-2-(3-phenylpropanoylamino)butanediamide.
| Compound Name | (2S)-N'-[(2-methylpropan-2-yl)oxy]-N-[(2S)-1-oxo-1-(quinolin-4-ylmethylamino)propan-2-yl]-2-(3-phenylpropanoylamino)butanediamide |
|---|---|
| PubChem CID | 129093859 |
| Molecular Formula | C30H37N5O5 |
| Molecular Weight | 547.66 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | (2S)-N'-[(2-methylpropan-2-yl)oxy]-N-[(2S)-1-oxo-1-(quinolin-4-ylmethylamino)propan-2-yl]-2-(3-phenylpropanoylamino)butanediamide |
| SMILES | C[C@H](NC(=O)[C@H](CC(=O)NOC(C)(C)C)NC(=O)CCc1ccccc1)C(=O)NCc1ccnc2ccccc12 |
| InChI | InChI=1S/C30H37N5O5/c1-20(28(38)32-19-22-16-17-31-24-13-9-8-12-23(22)24)33-29(39)25(18-27(37)35-40-30(2,3)4)34-26(36)15-14-21-10-6-5-7-11-21/h5-13,16-17,20,25H,14-15,18-19H2,1-4H3,(H,32,38)(H,33,39)(H,34,36)(H,35,37)/t20-,25-/m0/s1 |
| InChIKey | MTBGAOSBYWNSPB-CPJSRVTESA-N |
| XLogP | 2.71 |
| TPSA | 138.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.66 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|