C31H43N5O6 — CID 129093865
(2S)-N'-butoxy-N-[(2S)-3-methoxy-1-oxo-1-(1,2,3,4-tetrahydroquinolin-8-ylmethylamino)propan-2-yl]-2-(3-phenylpropanoylamino)butanediamide (PubChem CID 129093865) has the molecular formula C31H43N5O6 and a molecular weight of 581.71 g/mol. Its IUPAC name is (2S)-N'-butoxy-N-[(2S)-3-methoxy-1-oxo-1-(1,2,3,4-tetrahydroquinolin-8-ylmethylamino)propan-2-yl]-2-(3-phenylpropanoylamino)butanediamide.
| Compound Name | (2S)-N'-butoxy-N-[(2S)-3-methoxy-1-oxo-1-(1,2,3,4-tetrahydroquinolin-8-ylmethylamino)propan-2-yl]-2-(3-phenylpropanoylamino)butanediamide |
|---|---|
| PubChem CID | 129093865 |
| Molecular Formula | C31H43N5O6 |
| Molecular Weight | 581.71 g/mol |
| Exact Mass | 581.32 |
| IUPAC Name | (2S)-N'-butoxy-N-[(2S)-3-methoxy-1-oxo-1-(1,2,3,4-tetrahydroquinolin-8-ylmethylamino)propan-2-yl]-2-(3-phenylpropanoylamino)butanediamide |
| SMILES | CCCCONC(=O)C[C@H](NC(=O)CCc1ccccc1)C(=O)N[C@@H](COC)C(=O)NCc1cccc2c1NCCC2 |
| InChI | InChI=1S/C31H43N5O6/c1-3-4-18-42-36-28(38)19-25(34-27(37)16-15-22-10-6-5-7-11-22)31(40)35-26(21-41-2)30(39)33-20-24-13-8-12-23-14-9-17-32-29(23)24/h5-8,10-13,25-26,32H,3-4,9,14-21H2,1-2H3,(H,33,39)(H,34,37)(H,35,40)(H,36,38)/t25-,26-/m0/s1 |
| InChIKey | KRVROHRHFDNNFZ-UIOOFZCWSA-N |
| XLogP | 2.15 |
| TPSA | 146.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.71 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|