C10H15ClFN — CID 129094251
(1Z,3E,5E)-5-chloro-4-fluoro-3-propan-2-ylhepta-1,3,5-trien-1-amine (PubChem CID 129094251) has the molecular formula C10H15ClFN and a molecular weight of 203.69 g/mol. Its IUPAC name is (1Z,3E,5E)-5-chloro-4-fluoro-3-propan-2-ylhepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3E,5E)-5-chloro-4-fluoro-3-propan-2-ylhepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 129094251 |
| Molecular Formula | C10H15ClFN |
| Molecular Weight | 203.69 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (1Z,3E,5E)-5-chloro-4-fluoro-3-propan-2-ylhepta-1,3,5-trien-1-amine |
| SMILES | C/C=C(Cl)\C(F)=C(/C=C\N)C(C)C |
| InChI | InChI=1S/C10H15ClFN/c1-4-9(11)10(12)8(5-6-13)7(2)3/h4-7H,13H2,1-3H3/b6-5-,9-4+,10-8- |
| InChIKey | LNKGIOPSODYJNV-JJHLLQKUSA-N |
| XLogP | 3.48 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|