About 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol
1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol (PubChem CID 129095035) has the molecular formula C14H15NO
and a molecular weight of 213.28 g/mol. Its IUPAC name is 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol.
Molecular Properties
| Compound Name | 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol |
| PubChem CID | 129095035 |
| Molecular Formula | C14H15NO |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol |
| SMILES | C=C/C=c1/c(C=C)c(C(=C)O)[nH]/c1=C/C=C |
| InChI | InChI=1S/C14H15NO/c1-5-8-12-11(7-3)14(10(4)16)15-13(12)9-6-2/h5-9,15-16H,1-4H2/b12-8-,13-9+ |
| InChIKey | KOSXTERJKLRVJD-QRBCZBMESA-N |
| XLogP | 2.12 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol?
The IUPAC name of 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol (CID 129095035) is 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol.
What is the SMILES notation for 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol?
The canonical SMILES for 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol is C=C/C=c1/c(C=C)c(C(=C)O)[nH]/c1=C/C=C.
What is the InChIKey of 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol?
The InChIKey is KOSXTERJKLRVJD-QRBCZBMESA-N. The full InChI is InChI=1S/C14H15NO/c1-5-8-12-11(7-3)14(10(4)16)15-13(12)9-6-2/h5-9,15-16H,1-4H2/b12-8-,13-9+.
What are the key properties of 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol?
1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol has a molecular weight of 213.28 g/mol, XLogP of 2.12, 4 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(4Z,5E)-3-ethenyl-4,5-bis(prop-2-enylidene)-1H-pyrrol-2-yl]ethenol is sourced from PubChem (CID 129095035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).