About 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine
2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine (PubChem CID 129095490) has the molecular formula C22H19N
and a molecular weight of 297.40 g/mol. Its IUPAC name is 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine.
Molecular Properties
| Compound Name | 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine |
| PubChem CID | 129095490 |
| Molecular Formula | C22H19N |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine |
| SMILES | C=Cc1cc2c(cc1-c1ccccn1)C(C)(C)c1ccccc1-2 |
| InChI | InChI=1S/C22H19N/c1-4-15-13-18-16-9-5-6-10-19(16)22(2,3)20(18)14-17(15)21-11-7-8-12-23-21/h4-14H,1H2,2-3H3 |
| InChIKey | OESDRPOBVMUALV-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine?
The IUPAC name of 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine (CID 129095490) is 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine.
What is the SMILES notation for 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine?
The canonical SMILES for 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine is C=Cc1cc2c(cc1-c1ccccn1)C(C)(C)c1ccccc1-2.
What is the InChIKey of 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine?
The InChIKey is OESDRPOBVMUALV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N/c1-4-15-13-18-16-9-5-6-10-19(16)22(2,3)20(18)14-17(15)21-11-7-8-12-23-21/h4-14H,1H2,2-3H3.
What are the key properties of 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine?
2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine has a molecular weight of 297.40 g/mol, XLogP of 5.70, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethenyl-9,9-dimethylfluoren-2-yl)pyridine is sourced from PubChem (CID 129095490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).