C50H47N — CID 129095619
4-(9-cyclohexa-1,5-dien-1-yl-2-methyl-1,2,5,6-tetrahydrofluoren-9-yl)-9-[(1E,3E)-5-(3-methylcyclohexa-1,5-dien-1-yl)-3-phenylpenta-1,3-dienyl]carbazole (PubChem CID 129095619) has the molecular formula C50H47N and a molecular weight of 661.93 g/mol. Its IUPAC name is 4-(9-cyclohexa-1,5-dien-1-yl-2-methyl-1,2,5,6-tetrahydrofluoren-9-yl)-9-[(1E,3E)-5-(3-methylcyclohexa-1,5-dien-1-yl)-3-phenylpenta-1,3-dienyl]carbazole.
| Compound Name | 4-(9-cyclohexa-1,5-dien-1-yl-2-methyl-1,2,5,6-tetrahydrofluoren-9-yl)-9-[(1E,3E)-5-(3-methylcyclohexa-1,5-dien-1-yl)-3-phenylpenta-1,3-dienyl]carbazole |
|---|---|
| PubChem CID | 129095619 |
| Molecular Formula | C50H47N |
| Molecular Weight | 661.93 g/mol |
| Exact Mass | 661.37 |
| IUPAC Name | 4-(9-cyclohexa-1,5-dien-1-yl-2-methyl-1,2,5,6-tetrahydrofluoren-9-yl)-9-[(1E,3E)-5-(3-methylcyclohexa-1,5-dien-1-yl)-3-phenylpenta-1,3-dienyl]carbazole |
| SMILES | CC1C=C(C/C=C(\C=C\n2c3ccccc3c3c(C4(C5=CCCC=C5)C5=C(CCC=C5)C5=C4CC(C)C=C5)cccc32)c2ccccc2)C=CC1 |
| InChI | InChI=1S/C50H47N/c1-35-15-13-16-37(33-35)28-29-39(38-17-5-3-6-18-38)31-32-51-47-25-12-10-22-43(47)49-45(24-14-26-48(49)51)50(40-19-7-4-8-20-40)44-23-11-9-21-41(44)42-30-27-36(2)34-46(42)50/h3,5-7,10-14,16-20,22-27,29-33,35-36H,4,8-9,15,21,28,34H2,1-2H3/b32-31+,39-29+ |
| InChIKey | JGDYMGQXMAGZCR-XKAYJZKYSA-N |
| XLogP | 13.33 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.93 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|