About 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine
3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine (PubChem CID 129095722) has the molecular formula C11H21F3N2S
and a molecular weight of 270.36 g/mol. Its IUPAC name is 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine.
Molecular Properties
| Compound Name | 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine |
| PubChem CID | 129095722 |
| Molecular Formula | C11H21F3N2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine |
| SMILES | CC(N)C(C1CCC(SCN)CC1)C(F)(F)F |
| InChI | InChI=1S/C11H21F3N2S/c1-7(16)10(11(12,13)14)8-2-4-9(5-3-8)17-6-15/h7-10H,2-6,15-16H2,1H3 |
| InChIKey | SYHLNLNEEKOUDV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine?
The IUPAC name of 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine (CID 129095722) is 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine.
What is the SMILES notation for 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine?
The canonical SMILES for 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine is CC(N)C(C1CCC(SCN)CC1)C(F)(F)F.
What is the InChIKey of 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine?
The InChIKey is SYHLNLNEEKOUDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2S/c1-7(16)10(11(12,13)14)8-2-4-9(5-3-8)17-6-15/h7-10H,2-6,15-16H2,1H3.
What are the key properties of 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine?
3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine has a molecular weight of 270.36 g/mol, XLogP of 2.72, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(aminomethylsulfanyl)cyclohexyl]-4,4,4-trifluorobutan-2-amine is sourced from PubChem (CID 129095722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).