About N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine
N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine (PubChem CID 129095775) has the molecular formula C14H20N2S
and a molecular weight of 248.39 g/mol. Its IUPAC name is N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine.
Molecular Properties
| Compound Name | N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine |
| PubChem CID | 129095775 |
| Molecular Formula | C14H20N2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine |
| SMILES | C=C(NC)N(S)/C(=C\C)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C14H20N2S/c1-6-14(16(17)12(4)15-5)13-8-7-10(2)11(3)9-13/h6-9,15,17H,4H2,1-3,5H3/b14-6- |
| InChIKey | HPBQHMNAPRXDQC-NSIKDUERSA-N |
| XLogP | 3.50 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine?
The IUPAC name of N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine (CID 129095775) is N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine.
What is the SMILES notation for N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine?
The canonical SMILES for N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine is C=C(NC)N(S)/C(=C\C)c1ccc(C)c(C)c1.
What is the InChIKey of N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine?
The InChIKey is HPBQHMNAPRXDQC-NSIKDUERSA-N. The full InChI is InChI=1S/C14H20N2S/c1-6-14(16(17)12(4)15-5)13-8-7-10(2)11(3)9-13/h6-9,15,17H,4H2,1-3,5H3/b14-6-.
What are the key properties of N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine?
N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine has a molecular weight of 248.39 g/mol, XLogP of 3.50, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-1-(3,4-dimethylphenyl)prop-1-enyl]-N-[1-(methylamino)ethenyl]thiohydroxylamine is sourced from PubChem (CID 129095775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).