About (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine
(1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine (PubChem CID 129096112) has the molecular formula C6H8ClFN2
and a molecular weight of 162.59 g/mol. Its IUPAC name is (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine.
Molecular Properties
| Compound Name | (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine |
| PubChem CID | 129096112 |
| Molecular Formula | C6H8ClFN2 |
| Molecular Weight | 162.59 g/mol |
| Exact Mass | 162.04 |
| IUPAC Name | (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine |
| SMILES | C=N/C(Cl)=C(F)\C(N)=C/C |
| InChI | InChI=1S/C6H8ClFN2/c1-3-4(9)5(8)6(7)10-2/h3H,2,9H2,1H3/b4-3+,6-5+ |
| InChIKey | FBRMOJUVXGZAFL-VNKDHWASSA-N |
| XLogP | 1.93 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.59 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine?
The IUPAC name of (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine (CID 129096112) is (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine.
What is the SMILES notation for (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine?
The canonical SMILES for (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine is C=N/C(Cl)=C(F)\C(N)=C/C.
What is the InChIKey of (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine?
The InChIKey is FBRMOJUVXGZAFL-VNKDHWASSA-N. The full InChI is InChI=1S/C6H8ClFN2/c1-3-4(9)5(8)6(7)10-2/h3H,2,9H2,1H3/b4-3+,6-5+.
What are the key properties of (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine?
(1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine has a molecular weight of 162.59 g/mol, XLogP of 1.93, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z,3E)-1-chloro-2-fluoro-1-(methylideneamino)penta-1,3-dien-3-amine is sourced from PubChem (CID 129096112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).