About tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate
tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate (PubChem CID 129096338) has the molecular formula C16H26N2O3
and a molecular weight of 294.40 g/mol. Its IUPAC name is tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate |
| PubChem CID | 129096338 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1c1nc(C(C)(C)C)co1 |
| InChI | InChI=1S/C16H26N2O3/c1-15(2,3)12-10-20-13(17-12)11-8-7-9-18(11)14(19)21-16(4,5)6/h10-11H,7-9H2,1-6H3/t11-/m0/s1 |
| InChIKey | JFRCGJLWKDYYQS-NSHDSACASA-N |
| XLogP | 4.04 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate (CID 129096338) is tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC[C@H]1c1nc(C(C)(C)C)co1.
What is the InChIKey of tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate?
The InChIKey is JFRCGJLWKDYYQS-NSHDSACASA-N. The full InChI is InChI=1S/C16H26N2O3/c1-15(2,3)12-10-20-13(17-12)11-8-7-9-18(11)14(19)21-16(4,5)6/h10-11H,7-9H2,1-6H3/t11-/m0/s1.
What are the key properties of tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate?
tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate has a molecular weight of 294.40 g/mol, XLogP of 4.04, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S)-2-(4-tert-butyl-1,3-oxazol-2-yl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 129096338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).