C16H18N6O3 — CID 129097247
1-[[6-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-3-pyridinyl]methyl]triazole-4-carboxylic acid (PubChem CID 129097247) has the molecular formula C16H18N6O3 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-[[6-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-3-pyridinyl]methyl]triazole-4-carboxylic acid.
| Compound Name | 1-[[6-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-3-pyridinyl]methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 129097247 |
| Molecular Formula | C16H18N6O3 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | 1-[[6-(4-oxo-1,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-2-yl)-3-pyridinyl]methyl]triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn(Cc2ccc(N3CC(=O)N4CCCC4C3)nc2)nn1 |
| InChI | InChI=1S/C16H18N6O3/c23-15-10-20(8-12-2-1-5-22(12)15)14-4-3-11(6-17-14)7-21-9-13(16(24)25)18-19-21/h3-4,6,9,12H,1-2,5,7-8,10H2,(H,24,25) |
| InChIKey | JKCXSTJEKUKKGL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 104.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |