About benzene-1,3,5-triol;1H-benzimidazole
benzene-1,3,5-triol;1H-benzimidazole (PubChem CID 129097298) has the molecular formula C13H12N2O3
and a molecular weight of 244.25 g/mol. Its IUPAC name is benzene-1,3,5-triol;1H-benzimidazole.
Molecular Properties
| Compound Name | benzene-1,3,5-triol;1H-benzimidazole |
| PubChem CID | 129097298 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | benzene-1,3,5-triol;1H-benzimidazole |
| SMILES | Oc1cc(O)cc(O)c1.c1ccc2[nH]cnc2c1 |
| InChI | InChI=1S/C7H6N2.C6H6O3/c1-2-4-7-6(3-1)8-5-9-7;7-4-1-5(8)3-6(9)2-4/h1-5H,(H,8,9);1-3,7-9H |
| InChIKey | QVRGVINIAXYMMW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzene-1,3,5-triol;1H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene-1,3,5-triol;1H-benzimidazole?
The IUPAC name of benzene-1,3,5-triol;1H-benzimidazole (CID 129097298) is benzene-1,3,5-triol;1H-benzimidazole.
What is the SMILES notation for benzene-1,3,5-triol;1H-benzimidazole?
The canonical SMILES for benzene-1,3,5-triol;1H-benzimidazole is Oc1cc(O)cc(O)c1.c1ccc2[nH]cnc2c1.
What is the InChIKey of benzene-1,3,5-triol;1H-benzimidazole?
The InChIKey is QVRGVINIAXYMMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2.C6H6O3/c1-2-4-7-6(3-1)8-5-9-7;7-4-1-5(8)3-6(9)2-4/h1-5H,(H,8,9);1-3,7-9H.
What are the key properties of benzene-1,3,5-triol;1H-benzimidazole?
benzene-1,3,5-triol;1H-benzimidazole has a molecular weight of 244.25 g/mol, XLogP of 2.37, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzene-1,3,5-triol;1H-benzimidazole is sourced from PubChem (CID 129097298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).