C25H27N7O2 — CID 129097300
N-(2-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl)-1-[[4-(3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-2-yl)phenyl]methyl]triazole-4-carboxamide (PubChem CID 129097300) has the molecular formula C25H27N7O2 and a molecular weight of 457.54 g/mol. Its IUPAC name is N-(2-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl)-1-[[4-(3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-2-yl)phenyl]methyl]triazole-4-carboxamide.
| Compound Name | N-(2-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl)-1-[[4-(3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-2-yl)phenyl]methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 129097300 |
| Molecular Formula | C25H27N7O2 |
| Molecular Weight | 457.54 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | N-(2-amino-6,7-dihydro-5H-cyclopenta[b]pyridin-5-yl)-1-[[4-(3-oxo-1,2,5,6,7,8-hexahydropyrrolizin-2-yl)phenyl]methyl]triazole-4-carboxamide |
| SMILES | Nc1ccc2c(n1)CCC2NC(=O)c1cn(Cc2ccc(C3CC4CCCN4C3=O)cc2)nn1 |
| InChI | InChI=1S/C25H27N7O2/c26-23-10-7-18-20(27-23)8-9-21(18)28-24(33)22-14-31(30-29-22)13-15-3-5-16(6-4-15)19-12-17-2-1-11-32(17)25(19)34/h3-7,10,14,17,19,21H,1-2,8-9,11-13H2,(H2,26,27)(H,28,33) |
| InChIKey | QJBIDCRGSYPQSF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 119.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.54 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |