C20H21Cl2NO4 — CID 12909738
(8-acetyloxy-9-chloro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl) acetate;hydrochloride (PubChem CID 12909738) has the molecular formula C20H21Cl2NO4 and a molecular weight of 410.30 g/mol. Its IUPAC name is (8-acetyloxy-9-chloro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl) acetate;hydrochloride.
| Compound Name | (8-acetyloxy-9-chloro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl) acetate;hydrochloride |
|---|---|
| PubChem CID | 12909738 |
| Molecular Formula | C20H21Cl2NO4 |
| Molecular Weight | 410.30 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (8-acetyloxy-9-chloro-5-phenyl-2,3,4,5-tetrahydro-1H-3-benzazepin-7-yl) acetate;hydrochloride |
| SMILES | CC(=O)Oc1cc2c(c(Cl)c1OC(C)=O)CCNCC2c1ccccc1.Cl |
| InChI | InChI=1S/C20H20ClNO4.ClH/c1-12(23)25-18-10-16-15(19(21)20(18)26-13(2)24)8-9-22-11-17(16)14-6-4-3-5-7-14;/h3-7,10,17,22H,8-9,11H2,1-2H3;1H |
| InChIKey | ZZUHIGOKAVFWDF-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.30 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|