C15H19ClN4O4S — CID 129097803
8-chloro-N-methoxy-N-methyl-5-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)imidazo[1,5-a]pyridine-6-carboxamide (PubChem CID 129097803) has the molecular formula C15H19ClN4O4S and a molecular weight of 386.86 g/mol. Its IUPAC name is 8-chloro-N-methoxy-N-methyl-5-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)imidazo[1,5-a]pyridine-6-carboxamide.
| Compound Name | 8-chloro-N-methoxy-N-methyl-5-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)imidazo[1,5-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 129097803 |
| Molecular Formula | C15H19ClN4O4S |
| Molecular Weight | 386.86 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 8-chloro-N-methoxy-N-methyl-5-(2-methyl-1,1-dioxo-1,4-thiazinan-4-yl)imidazo[1,5-a]pyridine-6-carboxamide |
| SMILES | CON(C)C(=O)c1cc(Cl)c2cncn2c1N1CCS(=O)(=O)C(C)C1 |
| InChI | InChI=1S/C15H19ClN4O4S/c1-10-8-19(4-5-25(10,22)23)14-11(15(21)18(2)24-3)6-12(16)13-7-17-9-20(13)14/h6-7,9-10H,4-5,8H2,1-3H3 |
| InChIKey | HGZAWVCBWBDZEY-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.86 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|