C21H17Cl2F3N8O3 — CID 129098517
N-[1-(3-amino-4-chloro-[1,2]oxazolo[5,4-c]pyridin-7-yl)pyrrolidin-3-yl]-2-chloro-4-[5-oxo-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-4-yl]benzamide (PubChem CID 129098517) has the molecular formula C21H17Cl2F3N8O3 and a molecular weight of 557.32 g/mol. Its IUPAC name is N-[1-(3-amino-4-chloro-[1,2]oxazolo[5,4-c]pyridin-7-yl)pyrrolidin-3-yl]-2-chloro-4-[5-oxo-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-4-yl]benzamide.
| Compound Name | N-[1-(3-amino-4-chloro-[1,2]oxazolo[5,4-c]pyridin-7-yl)pyrrolidin-3-yl]-2-chloro-4-[5-oxo-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 129098517 |
| Molecular Formula | C21H17Cl2F3N8O3 |
| Molecular Weight | 557.32 g/mol |
| Exact Mass | 556.08 |
| IUPAC Name | N-[1-(3-amino-4-chloro-[1,2]oxazolo[5,4-c]pyridin-7-yl)pyrrolidin-3-yl]-2-chloro-4-[5-oxo-1-(2,2,2-trifluoroethyl)-1,2,4-triazol-4-yl]benzamide |
| SMILES | Nc1noc2c(N3CCC(NC(=O)c4ccc(-n5cnn(CC(F)(F)F)c5=O)cc4Cl)C3)ncc(Cl)c12 |
| InChI | InChI=1S/C21H17Cl2F3N8O3/c22-13-5-11(33-9-29-34(20(33)36)8-21(24,25)26)1-2-12(13)19(35)30-10-3-4-32(7-10)18-16-15(14(23)6-28-18)17(27)31-37-16/h1-2,5-6,9-10H,3-4,7-8H2,(H2,27,31)(H,30,35) |
| InChIKey | ONEGGEQTZJFVSJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |