C7H14N2S — CID 129098843
2-methyl-1,3,5,6,8,8a-hexahydroimidazo[5,1-c][1,4]thiazine (PubChem CID 129098843) has the molecular formula C7H14N2S and a molecular weight of 158.27 g/mol. Its IUPAC name is 2-methyl-1,3,5,6,8,8a-hexahydroimidazo[5,1-c][1,4]thiazine.
| Compound Name | 2-methyl-1,3,5,6,8,8a-hexahydroimidazo[5,1-c][1,4]thiazine |
|---|---|
| PubChem CID | 129098843 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 2-methyl-1,3,5,6,8,8a-hexahydroimidazo[5,1-c][1,4]thiazine |
| SMILES | CN1CC2CSCCN2C1 |
| InChI | InChI=1S/C7H14N2S/c1-8-4-7-5-10-3-2-9(7)6-8/h7H,2-6H2,1H3 |
| InChIKey | IOSFDCMCGKSLDX-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |