About 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine
6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine (PubChem CID 129098866) has the molecular formula C7H9N3
and a molecular weight of 135.17 g/mol. Its IUPAC name is 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine.
Molecular Properties
| Compound Name | 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine |
| PubChem CID | 129098866 |
| Molecular Formula | C7H9N3 |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine |
| SMILES | CN1Cc2cnncc2C1 |
| InChI | InChI=1S/C7H9N3/c1-10-4-6-2-8-9-3-7(6)5-10/h2-3H,4-5H2,1H3 |
| InChIKey | VUUDBGPMBXNNHV-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine?
The IUPAC name of 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine (CID 129098866) is 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine.
What is the SMILES notation for 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine?
The canonical SMILES for 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine is CN1Cc2cnncc2C1.
What is the InChIKey of 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine?
The InChIKey is VUUDBGPMBXNNHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3/c1-10-4-6-2-8-9-3-7(6)5-10/h2-3H,4-5H2,1H3.
What are the key properties of 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine?
6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine has a molecular weight of 135.17 g/mol, XLogP of 0.42, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-5,7-dihydropyrrolo[3,4-d]pyridazine is sourced from PubChem (CID 129098866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).