About 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine
1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine (PubChem CID 129099054) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine |
| PubChem CID | 129099054 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine |
| SMILES | CC1=NC2N=CC=CC2N1C |
| InChI | InChI=1S/C8H11N3/c1-6-10-8-7(11(6)2)4-3-5-9-8/h3-5,7-8H,1-2H3 |
| InChIKey | XYYKUGRWMINQHW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine?
The IUPAC name of 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine (CID 129099054) is 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine.
What is the SMILES notation for 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine?
The canonical SMILES for 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine is CC1=NC2N=CC=CC2N1C.
What is the InChIKey of 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine?
The InChIKey is XYYKUGRWMINQHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-6-10-8-7(11(6)2)4-3-5-9-8/h3-5,7-8H,1-2H3.
What are the key properties of 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine?
1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine has a molecular weight of 149.20 g/mol, XLogP of 0.69, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethyl-3a,7a-dihydroimidazo[4,5-b]pyridine is sourced from PubChem (CID 129099054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).