About tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate
tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate (PubChem CID 129099295) has the molecular formula C12H14F3N3O5S
and a molecular weight of 369.32 g/mol. Its IUPAC name is tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
| PubChem CID | 129099295 |
| Molecular Formula | C12H14F3N3O5S |
| Molecular Weight | 369.32 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1Cc2cnc(OS(=O)(=O)C(F)(F)F)nc2C1 |
| InChI | InChI=1S/C12H14F3N3O5S/c1-11(2,3)22-10(19)18-5-7-4-16-9(17-8(7)6-18)23-24(20,21)12(13,14)15/h4H,5-6H2,1-3H3 |
| InChIKey | GEDDQULQEHYUMP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 98.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate?
The IUPAC name of tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate (CID 129099295) is tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate.
What is the SMILES notation for tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate?
The canonical SMILES for tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate is CC(C)(C)OC(=O)N1Cc2cnc(OS(=O)(=O)C(F)(F)F)nc2C1.
What is the InChIKey of tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate?
The InChIKey is GEDDQULQEHYUMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F3N3O5S/c1-11(2,3)22-10(19)18-5-7-4-16-9(17-8(7)6-18)23-24(20,21)12(13,14)15/h4H,5-6H2,1-3H3.
What are the key properties of tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate?
tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate has a molecular weight of 369.32 g/mol, XLogP of 1.96, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(trifluoromethylsulfonyloxy)-5,7-dihydropyrrolo[3,4-d]pyrimidine-6-carboxylate is sourced from PubChem (CID 129099295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).