C25H37N7O — CID 129099320
5-[[2-methoxy-5-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine (PubChem CID 129099320) has the molecular formula C25H37N7O and a molecular weight of 451.62 g/mol. Its IUPAC name is 5-[[2-methoxy-5-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 5-[[2-methoxy-5-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 129099320 |
| Molecular Formula | C25H37N7O |
| Molecular Weight | 451.62 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | 5-[[2-methoxy-5-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]-4-N-pentylpyrrolo[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(N)nc2ccn(Cc3cc(CN4CCN(C)CC4)ccc3OC)c12 |
| InChI | InChI=1S/C25H37N7O/c1-4-5-6-10-27-24-23-21(28-25(26)29-24)9-11-32(23)18-20-16-19(7-8-22(20)33-3)17-31-14-12-30(2)13-15-31/h7-9,11,16H,4-6,10,12-15,17-18H2,1-3H3,(H3,26,27,28,29) |
| InChIKey | AJEKHLSHJFYFLQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 84.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.62 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|