C20H15F5N4S — CID 129099698
3-ethylsulfanyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridin-2-yl]quinoline (PubChem CID 129099698) has the molecular formula C20H15F5N4S and a molecular weight of 438.43 g/mol. Its IUPAC name is 3-ethylsulfanyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridin-2-yl]quinoline.
| Compound Name | 3-ethylsulfanyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridin-2-yl]quinoline |
|---|---|
| PubChem CID | 129099698 |
| Molecular Formula | C20H15F5N4S |
| Molecular Weight | 438.43 g/mol |
| Exact Mass | 438.09 |
| IUPAC Name | 3-ethylsulfanyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-c]pyridin-2-yl]quinoline |
| SMILES | CCSc1cc2ccccc2nc1-c1nc2cc(C(F)(F)C(F)(F)F)ncc2n1C |
| InChI | InChI=1S/C20H15F5N4S/c1-3-30-15-8-11-6-4-5-7-12(11)27-17(15)18-28-13-9-16(19(21,22)20(23,24)25)26-10-14(13)29(18)2/h4-10H,3H2,1-2H3 |
| InChIKey | GIWYFJORPDJIHO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.43 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|