C20H15F5N4O2S — CID 129099949
3-ethylsulfonyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]quinoline (PubChem CID 129099949) has the molecular formula C20H15F5N4O2S and a molecular weight of 470.42 g/mol. Its IUPAC name is 3-ethylsulfonyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]quinoline.
| Compound Name | 3-ethylsulfonyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]quinoline |
|---|---|
| PubChem CID | 129099949 |
| Molecular Formula | C20H15F5N4O2S |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 3-ethylsulfonyl-2-[3-methyl-6-(1,1,2,2,2-pentafluoroethyl)imidazo[4,5-b]pyridin-2-yl]quinoline |
| SMILES | CCS(=O)(=O)c1cc2ccccc2nc1-c1nc2cc(C(F)(F)C(F)(F)F)cnc2n1C |
| InChI | InChI=1S/C20H15F5N4O2S/c1-3-32(30,31)15-8-11-6-4-5-7-13(11)27-16(15)18-28-14-9-12(10-26-17(14)29(18)2)19(21,22)20(23,24)25/h4-10H,3H2,1-2H3 |
| InChIKey | UOQFGAIENKENKC-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|